CAS
92257-40-4 Purity
---
92257-40-4 Purity
---
Inquiry Basket
Isoindolin-4-amine hydrochloride
CAS
92259-85-3
Catalog Number
ACM92259853
Category
Other Products
Molecular Formula
C8H12Cl2N2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
ISOINDOLIN-4-AMINE 2HCL;Isoindolin-4-amine hydrochloride
What is the PubChem CID for Isoindolin-4-amine hydrochloride?
PubChem CID 53419492
What is the molecular formula of Isoindolin-4-amine hydrochloride?
The molecular formula is C8H11ClN2.
What are the synonyms for Isoindolin-4-amine hydrochloride?
The synonyms are ISOINDOLIN-4-AMINE HYDROCHLORIDE, 1260847-41-3, 2,3-DIHYDRO-1H-ISOINDOL-4-AMINE HYDROCHLORIDE, 1H-Isoindol-4-amine, 2,3-dihydro-, hydrochloride (1:1), Isoindolin-4-amine HCl.
What is the molecular weight of Isoindolin-4-amine hydrochloride?
The molecular weight is 170.64 g/mol.
What is the IUPAC name of Isoindolin-4-amine hydrochloride?
The IUPAC name is 2,3-dihydro-1H-isoindol-4-amine hydrochloride.
What is the InChI of Isoindolin-4-amine hydrochloride?
The InChI is InChI=1S/C8H10N2.ClH/c9-8-3-1-2-6-4-10-5-7(6)8;/h1-3,10H,4-5,9H2;1H.
What is the InChIKey of Isoindolin-4-amine hydrochloride?
The InChIKey is AHKXBWVFGYQNQZ-UHFFFAOYSA-N.
What is the canonical SMILES of Isoindolin-4-amine hydrochloride?
The canonical SMILES is C1C2=C(CN1)C(=CC=C2)N.Cl.
How many hydrogen bond donor counts does Isoindolin-4-amine hydrochloride have?
It has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Isoindolin-4-amine hydrochloride have?
It has 2 hydrogen bond acceptor counts.
What is the PubChem CID of Isoindolin-4-amine hydrochloride?
The PubChem CID of Isoindolin-4-amine hydrochloride is 53419492.
What is the hydrogen bond donor count of Isoindolin-4-amine hydrochloride?
The hydrogen bond donor count of Isoindolin-4-amine hydrochloride is 3.
What is the hydrogen bond acceptor count of Isoindolin-4-amine hydrochloride?
The hydrogen bond acceptor count of Isoindolin-4-amine hydrochloride is 2.
Is Isoindolin-4-amine hydrochloride a canonicalized compound?
Yes, Isoindolin-4-amine hydrochloride is a canonicalized compound.
Recommended Products
![Imidazo[4,5,1-jk][1]benzazepine-2,7(1H,4H)-dione,5,6-dihydro-](https://resource.alfa-chemistry.com/structure/92260-81-6.gif)
CAS
92260-81-6 Purity
---
92260-81-6 Purity
---
