What is the molecular formula of N-Methyl-(2-phenylpyrimidin-5-yl)methylamine?
The molecular formula is C12H13N3.
What is the computed molecular weight of N-Methyl-(2-phenylpyrimidin-5-yl)methylamine?
The computed molecular weight is 199.25 g/mol.
What are some synonyms for N-Methyl-(2-phenylpyrimidin-5-yl)methylamine?
Some synonyms include N-methyl-1-(2-phenylpyrimidin-5-yl)methanamine and methyl[(2-phenylpyrimidin-5-yl)methyl]amine.
When was N-Methyl-(2-phenylpyrimidin-5-yl)methylamine first created in the PubChem database?
It was first created on February 29, 2008.
What is the InChI of N-Methyl-(2-phenylpyrimidin-5-yl)methylamine?
The InChI is InChI=1S/C12H13N3/c1-13-7-10-8-14-12(15-9-10)11-5-3-2-4-6-11/h2-6,8-9,13H,7H2,1H3.
What is the InChIKey of N-Methyl-(2-phenylpyrimidin-5-yl)methylamine?
The InChIKey is BEURLXDVKSQEIQ-UHFFFAOYSA-N.
How many hydrogen bond donor counts does N-Methyl-(2-phenylpyrimidin-5-yl)methylamine have?
It has 1 hydrogen bond donor count.
What is the XLogP3-AA value of N-Methyl-(2-phenylpyrimidin-5-yl)methylamine?
The XLogP3-AA value is 1.2.
What is the topological polar surface area of N-Methyl-(2-phenylpyrimidin-5-yl)methylamine?
The topological polar surface area is 37.8 Å2.
Is N-Methyl-(2-phenylpyrimidin-5-yl)methylamine a canonicalized compound?
Yes, it is a canonicalized compound.