What is the molecular formula of Methyl 3-[3-(dimethylamino)propoxy]benzoate?
The molecular formula is C13H19NO3.
When was Methyl 3-[3-(dimethylamino)propoxy]benzoate created and modified?
It was created on 2008-02-29 and modified on 2023-12-30.
What is the IUPAC name of Methyl 3-[3-(dimethylamino)propoxy]benzoate?
The IUPAC name is methyl 3-[3-(dimethylamino)propoxy]benzoate.
What is the InChI of Methyl 3-[3-(dimethylamino)propoxy]benzoate?
The InChI is InChI=1S/C13H19NO3/c1-14(2)8-5-9-17-12-7-4-6-11(10-12)13(15)16-3/h4,6-7,10H,5,8-9H2,1-3H3.
What is the Canonical SMILES of Methyl 3-[3-(dimethylamino)propoxy]benzoate?
The Canonical SMILES is CN(C)CCCOC1=CC=CC(=C1)C(=O)OC.
What is the molecular weight of Methyl 3-[3-(dimethylamino)propoxy]benzoate?
The molecular weight is 237.29 g/mol.
How many hydrogen bond acceptors does Methyl 3-[3-(dimethylamino)propoxy]benzoate have?
It has 4 hydrogen bond acceptors.
What is the topological polar surface area of Methyl 3-[3-(dimethylamino)propoxy]benzoate?
The topological polar surface area is 38.8 Ų.
How many heavy atoms are present in Methyl 3-[3-(dimethylamino)propoxy]benzoate?
There are 17 heavy atoms.
Is Methyl 3-[3-(dimethylamino)propoxy]benzoate a canonicalized compound according to PubChem?
Yes, it is a canonicalized compound.