What is the molecular formula of 3-Quinolinemethanol,2-chloro-6-methoxy?
The molecular formula is C11H10ClNO2.
What is the molecular weight of 3-Quinolinemethanol,2-chloro-6-methoxy?
The molecular weight is 223.65 g/mol.
What is the IUPAC name of 3-Quinolinemethanol,2-chloro-6-methoxy?
The IUPAC name is (2-chloro-6-methoxyquinolin-3-yl)methanol.
What is the InChI of 3-Quinolinemethanol,2-chloro-6-methoxy?
The InChI is InChI=1S/C11H10ClNO2/c1-15-9-2-3-10-7(5-9)4-8(6-14)11(12)13-10/h2-5,14H,6H2,1H3.
What is the InChIKey of 3-Quinolinemethanol,2-chloro-6-methoxy?
The InChIKey is AKKPSGFLKITYGV-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Quinolinemethanol,2-chloro-6-methoxy?
The canonical SMILES is COC1=CC2=CC(=C(N=C2C=C1)Cl)CO.
What is the CAS number of 3-Quinolinemethanol,2-chloro-6-methoxy?
The CAS number is 92172-83-3.
What is the XLogP3-AA value of 3-Quinolinemethanol,2-chloro-6-methoxy?
The XLogP3-AA value is 2.2.
How many hydrogen bond donor counts does 3-Quinolinemethanol,2-chloro-6-methoxy have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of 3-Quinolinemethanol,2-chloro-6-methoxy?
The topological polar surface area is 42.4 ?2.