920501-69-5 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C9H9ClFN.
The molecular weight of the compound is 185.62 g/mol.
The IUPAC name of the compound is 1-(4-chloro-2-fluorophenyl)cyclopropan-1-amine.
The InChIKey of the compound is MIOAWDZKXBHHLC-UHFFFAOYSA-N.
The Canonical SMILES of the compound is C1CC1(C2=C(C=C(C=C2)Cl)F)N.
The XLogP3-AA value of the compound is 1.9.
The compound has 1 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 26.2.
Yes, the compound is canonicalized.