What is the molecular formula of 5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-2-naphthylamine?
The molecular formula is C14H21N.
What is the molecular weight of 5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-2-naphthylamine?
The molecular weight is 203.32 g/mol.
When was 5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-2-naphthylamine created in PubChem?
It was created on October 26, 2006.
What is the InChIKey of 5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-2-naphthylamine?
The InChIKey is AMDKYPNODLTUMY-UHFFFAOYSA-N.
What is the Canonical SMILES of 5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-2-naphthylamine?
The Canonical SMILES is CC1(CCC(C2=C1C=CC(=C2)N)(C)C).
What is the XLogP3-AA value of 5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-2-naphthylamine?
The XLogP3-AA value is 4.4.
How many hydrogen bond donor count does 5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-2-naphthylamine have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of 5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-2-naphthylamine?
The topological polar surface area is 26.2.
How many heavy atoms are present in the structure of 5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-2-naphthylamine?
There are 15 heavy atoms present.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.