What is the molecular formula of Acetamide, 2-chloro-N-(3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl)?
The molecular formula is C13H14ClN3O.
When was Acetamide, 2-chloro-N-(3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl) created and modified?
It was created on July 15, 2005, and last modified on December 30, 2023.
What is the IUPAC name of Acetamide, 2-chloro-N-(3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl)?
The IUPAC name is 2-chloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetamide.
What is the InChI of Acetamide, 2-chloro-N-(3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl)?
The InChI is InChI=1S/C13H14ClN3O/c1-9-13(15-12(18)8-14)10(2)17(16-9)11-6-4-3-5-7-11/h3-7H,8H2,1-2H3,(H,15,18).
What is the molecular weight of Acetamide, 2-chloro-N-(3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl)?
The molecular weight is 263.72 g/mol.
What is the CAS number of Acetamide, 2-chloro-N-(3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl)?
The CAS number is 92026-64-7.
How many hydrogen bond donor counts does Acetamide, 2-chloro-N-(3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl) have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of Acetamide, 2-chloro-N-(3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl)?
The topological polar surface area is 46.9 Ų.
Is Acetamide, 2-chloro-N-(3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl) a canonicalized compound?
Yes, it is a canonicalized compound.
How many covalently-bonded units are present in Acetamide, 2-chloro-N-(3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl)?
There is 1 covalently-bonded unit in Acetamide, 2-chloro-N-(3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl).