What is the molecular formula of Benzeneacetic acid, a-hydroxy-a-(1,1,2,2,2-pentafluoroethyl)-,(as)-?
The molecular formula is C11H9F5O3.
What are the synonyms for Benzeneacetic acid, a-hydroxy-a-(1,1,2,2,2-pentafluoroethyl)-,(as)-?
The synonyms are 3,3,4,4,4-PENTAFLUORO-2-HYDROXY-2-(P-TOLYL)-BUTYRIC ACID and 3,3,4,4,4-Pentafluoro-2-hydroxy-2-(p-tolyl)butanoic acid, among others.
What is the molecular weight of Benzeneacetic acid, a-hydroxy-a-(1,1,2,2,2-pentafluoroethyl)-,(as)-?
The molecular weight is 284.18 g/mol.
What is the IUPAC name of Benzeneacetic acid, a-hydroxy-a-(1,1,2,2,2-pentafluoroethyl)-,(as)-?
The IUPAC name is 3,3,4,4,4-pentafluoro-2-hydroxy-2-(4-methylphenyl)butanoic acid.
What is the InChI key of Benzeneacetic acid, a-hydroxy-a-(1,1,2,2,2-pentafluoroethyl)-,(as)-?
The InChI key is DFGNEAIEJDJVKM-UHFFFAOYSA-N.
What is the canonical SMILES of Benzeneacetic acid, a-hydroxy-a-(1,1,2,2,2-pentafluoroethyl)-,(as)-?
The canonical SMILES is CC1=CC=C(C=C1)C(C(=O)O)(C(C(F)(F)F)(F)F)O.
What is the XLogP3-AA value of Benzeneacetic acid, a-hydroxy-a-(1,1,2,2,2-pentafluoroethyl)-,(as)-?
The XLogP3-AA value is 2.8.
How many hydrogen bond donor counts does Benzeneacetic acid, a-hydroxy-a-(1,1,2,2,2-pentafluoroethyl)-,(as)- have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Benzeneacetic acid, a-hydroxy-a-(1,1,2,2,2-pentafluoroethyl)-,(as)- have?
It has 8 hydrogen bond acceptor counts.
How many rotatable bond counts does Benzeneacetic acid, a-hydroxy-a-(1,1,2,2,2-pentafluoroethyl)-,(as)- have?
It has 3 rotatable bond counts.