91898-93-0 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C13H20N2.
The molecular weight of the compound is 204.31 g/mol.
The IUPAC name of the compound is 3-[(3-methylpiperidin-1-yl)methyl]aniline.
The Canonical SMILES representation of the compound is CC1CCCN(C1)CC2=CC(=CC=C2)N.
The InChIKey of the compound is FBNVXAZXOQRQHJ-UHFFFAOYSA-N.
The compound has 1 hydrogen bond donor count.
The XLogP3-AA value of the compound is 2.4.
The topological polar surface area of the compound is 29.3 Å2.
No, the compound does not have any defined atom stereocenter count.
Yes, the compound is canonicalized.