What is the molecular formula of 4-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine?
The molecular formula is C7H4ClN3O2.
When was 4-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine created in PubChem?
It was created on February 29, 2008.
What is the molecular weight of 4-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine?
The molecular weight is 197.58 g/mol.
What is the InChI for 4-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine?
The InChI is InChI=1S/C7H4ClN3O2/c8-4-1-2-9-7-6(4)5(3-10-7)11(12)13/h1-3H,(H,9,10).
What is the InChIKey for 4-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is KCCXAUDAHDKANR-UHFFFAOYSA-N.
What is the Canonical SMILES for 4-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine?
The Canonical SMILES is C1=CN=C2C(=C1Cl)C(=CN2)[N+](=O)[O-].
How many hydrogen bond donor counts does 4-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of 4-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine?
The topological polar surface area is 74.5 Ų.
How many heavy atoms are present in 4-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine?
There are 13 heavy atoms present.
Is the compound canonicalized?
Yes, the compound is canonicalized.