What is the molecular formula of Benzenesulfinic acid, 4-methyl-,(1S,2R,5S)-5-methyl-2-(1-methylethyl)cyclohexylester?
The molecular formula is C17H26O2S.
When was the structure of Benzenesulfinic acid, 4-methyl-,(1S,2R,5S)-5-methyl-2-(1-methylethyl)cyclohexylester created?
The structure was created on October 26, 2006.
What is the IUPAC name of Benzenesulfinic acid, 4-methyl-,(1S,2R,5S)-5-methyl-2-(1-methylethyl)cyclohexylester?
The IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-methylbenzenesulfinate.
What is the Canonical SMILES of Benzenesulfinic acid, 4-methyl-,(1S,2R,5S)-5-methyl-2-(1-methylethyl)cyclohexylester?
The Canonical SMILES is CC1CCC(C(C1)OS(=O)C2=CC=C(C=C2)C)C(C)C.
What is the InChIKey of Benzenesulfinic acid, 4-methyl-,(1S,2R,5S)-5-methyl-2-(1-methylethyl)cyclohexylester?
The InChIKey is NQICGNSARVCSGJ-IUINDACWSA-N.
What is the molecular weight of Benzenesulfinic acid, 4-methyl-,(1S,2R,5S)-5-methyl-2-(1-methylethyl)cyclohexylester?
The molecular weight is 294.5 g/mol.
How many hydrogen bond donor count does Benzenesulfinic acid, 4-methyl-,(1S,2R,5S)-5-methyl-2-(1-methylethyl)cyclohexylester have?
It has 0 hydrogen bond donor count.
What is the topological polar surface area of Benzenesulfinic acid, 4-methyl-,(1S,2R,5S)-5-methyl-2-(1-methylethyl)cyclohexylester?
The topological polar surface area is 45.5 Ų.
How many defined atom stereocenter count does Benzenesulfinic acid, 4-methyl-,(1S,2R,5S)-5-methyl-2-(1-methylethyl)cyclohexylester have?
It has 3 defined atom stereocenter count.
Is the compound canonicalized?
Yes, the compound is canonicalized according to PubChem (release 2021.10.14).