(2R)-2-Acetamido-3-[(1-hydroxy-3-methoxy-7-methyl-5,8-dioxonaphthalen-2-yl)methylsulfanyl]propanoic acid

CAS

91776-42-0

Catalog Number

ACM91776420

Category

Other Products

Molecular Weight

393.411 g/mol

Molecular Formula

C₁₈H₁₉NO₇S

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

Fibrostatin A, CID56293, LS-58993, L-Cysteine, N-acetyl-S-((5,8-dihydro-1-hydroxy-3-methoxy-7-methyl-5,8-dioxo-2-naphthalenyl)methyl)-, 91776-42-0

IUPAC Name

(2R)-2-acetamido-3-[(1-hydroxy-3-methoxy-7-methyl-5,8-dioxonaphthalen-2-yl)methylsulfanyl]propanoic acid

InChI Key

FDDCAZRCTMQKHP-LBPRGKRZSA-N

Exact Mass

393.08800

H-Bond Acceptor

H-Bond Donor

What is the molecular formula of Fibrostatin A?

The molecular formula of Fibrostatin A is C18H19NO7S.

What is the molecular weight of Fibrostatin A?

The molecular weight of Fibrostatin A is 393.4 g/mol.

What is the IUPAC name of Fibrostatin A?

The IUPAC name of Fibrostatin A is (2R)-2-acetamido-3-[(1-hydroxy-3-methoxy-7-methyl-5,8-dioxonaphthalen-2-yl)methylsulfanyl]propanoic acid.

What is the InChI key of Fibrostatin A?

The InChI key of Fibrostatin A is FDDCAZRCTMQKHP-LBPRGKRZSA-N.

What are the synonyms of Fibrostatin A?

The synonyms of Fibrostatin A are Fibrostatin A, 91776-42-0, and L-Cysteine, N-acetyl-S-((5,8-dihydro-1-hydroxy-3-methoxy-7-methyl-5,8-dioxo-2-naphthalenyl)methyl)-.

What is the canonical SMILES of Fibrostatin A?

The canonical SMILES of Fibrostatin A is CC1=CC(=O)C2=CC(=C(C(=C2C1=O)O)CSCC(C(=O)O)NC(=O)C)OC.

What is the InChI of Fibrostatin A?

The InChI of Fibrostatin A is InChI=1S/C18H19NO7S/c1-8-4-13(21)10-5-14(26-3)11(17(23)15(10)16(8)22)6-27-7-12(18(24)25)19-9(2)20/h4-5,12,23H,6-7H2,1-3H3,(H,19,20)(H,24,25)/t12-/m0/s1.

What is the hydrogen bond donor count of Fibrostatin A?

The hydrogen bond donor count of Fibrostatin A is 3.

What is the hydrogen bond acceptor count of Fibrostatin A?

The hydrogen bond acceptor count of Fibrostatin A is 8.

What is the topological polar surface area of Fibrostatin A?

The topological polar surface area of Fibrostatin A is 155 Å2.

Recommended Products