What is the molecular formula of 2-Chloro-6,8-dimethylquinoline-3-carbonitrile?
The molecular formula is C12H9ClN2.
What is the molecular weight of 2-Chloro-6,8-dimethylquinoline-3-carbonitrile?
The molecular weight is 216.66 g/mol.
What is the IUPAC name of 2-Chloro-6,8-dimethylquinoline-3-carbonitrile?
The IUPAC name is 2-chloro-6,8-dimethylquinoline-3-carbonitrile.
What is the InChI of 2-Chloro-6,8-dimethylquinoline-3-carbonitrile?
The InChI is InChI=1S/C12H9ClN2/c1-7-3-8(2)11-9(4-7)5-10(6-14)12(13)15-11/h3-5H,1-2H3.
What are the synonyms for 2-Chloro-6,8-dimethylquinoline-3-carbonitrile?
The synonyms include 2-Chloro-6,8-dimethyl-quinoline-3-carbonitrile and DTXSID50588989.
What is the Canonical SMILES of 2-Chloro-6,8-dimethylquinoline-3-carbonitrile?
The Canonical SMILES is CC1=CC(=C2C(=C1)C=C(C(=N2)Cl)C#N)C.
What is the XLogP3-AA value for 2-Chloro-6,8-dimethylquinoline-3-carbonitrile?
The XLogP3-AA value is 3.6.
How many hydrogen bond acceptors are there in 2-Chloro-6,8-dimethylquinoline-3-carbonitrile?
There are 2 hydrogen bond acceptors.
What is the topological polar surface area of 2-Chloro-6,8-dimethylquinoline-3-carbonitrile?
The topological polar surface area is 36.7 Ų.
Is 2-Chloro-6,8-dimethylquinoline-3-carbonitrile a canonicalized compound?
Yes, the compound is canonicalized.