What is the molecular formula of [2-(Trimethylammonium)ethyl]methanethiosulfonate bromide?
The molecular formula is C6H16BrNO2S2.
What is the molecular weight of [2-(Trimethylammonium)ethyl]methanethiosulfonate bromide?
The molecular weight is 278.2 g/mol.
What are some synonyms for [2-(Trimethylammonium)ethyl]methanethiosulfonate bromide?
Some synonyms include MTSET, 91774-25-3, and [2-(Trimethylammonium)ethyl]methanethiosulfonate Bromide.
When was [2-(Trimethylammonium)ethyl]methanethiosulfonate bromide created and last modified?
It was created on 2005-08-08 and last modified on 2023-12-30.
What is the IUPAC name of [2-(Trimethylammonium)ethyl]methanethiosulfonate bromide?
The IUPAC name is trimethyl(2-methylsulfonylsulfanylethyl)azanium;bromide.
What is the InChIKey of [2-(Trimethylammonium)ethyl]methanethiosulfonate bromide?
The InChIKey is DZWJBKUVHJSHAR-UHFFFAOYSA-M.
What is the canonical SMILES representation of [2-(Trimethylammonium)ethyl]methanethiosulfonate bromide?
The canonical SMILES is C[N+](C)(C)CCSS(=O)(=O)C.[Br-].
What is the CAS number of [2-(Trimethylammonium)ethyl]methanethiosulfonate bromide?
The CAS number is 155450-08-1.
How many hydrogen bond acceptors are in [2-(Trimethylammonium)ethyl]methanethiosulfonate bromide?
There are 4 hydrogen bond acceptors.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.