91745-87-8 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C13H18N2O2.
One of the synonyms for the compound is (R)-Benzyl 3-(methylamino)pyrrolidine-1-carboxylate.
The molecular weight of the compound is 234.29 g/mol.
The compound was created on June 21, 2011.
The IUPAC name of the compound is benzyl (3R)-3-(methylamino)pyrrolidine-1-carboxylate.
The InChI of the compound is InChI=1S/C13H18N2O2/c1-14-12-7-8-15(9-12)13(16)17-10-11-5-3-2-4-6-11/h2-6,12,14H,7-10H2,1H3/t12-/m1/s1.
The InChIKey of the compound is XGJOYHWLQXYOPI-GFCCVEGCSA-N.
The canonical SMILES of the compound is CNC1CCN(C1)C(=O)OCC2=CC=CC=C2.
The hydrogen bond acceptor count of the compound is 3.
Yes, the compound is canonicalized.