What is the molecular formula of 3-Borono-5-fluoro-4-methylbenzoic acid?
The molecular formula is C8H8BFO4.
When was 3-Borono-5-fluoro-4-methylbenzoic acid created in PubChem?
It was created on November 30, 2012.
What is the IUPAC name of 3-Borono-5-fluoro-4-methylbenzoic acid?
The IUPAC name is 3-borono-5-fluoro-4-methylbenzoic acid.
What is the InChI of 3-Borono-5-fluoro-4-methylbenzoic acid?
The InChI is InChI=1S/C8H8BFO4/c1-4-6(9(13)14)2-5(8(11)12)3-7(4)10/h2-3,13-14H,1H3,(H,11,12).
What is the InChIKey of 3-Borono-5-fluoro-4-methylbenzoic acid?
The InChIKey is KLHYMSYPRCYQQZ-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Borono-5-fluoro-4-methylbenzoic acid?
The canonical SMILES is B(C1=CC(=CC(=C1C)F)C(=O)O)(O)O.
What is the CAS identifier of 3-Borono-5-fluoro-4-methylbenzoic acid?
The CAS identifier is 917223-87-1.
What is the molecular weight of 3-Borono-5-fluoro-4-methylbenzoic acid?
The molecular weight is 197.96 g/mol.
How many hydrogen bond donor count does 3-Borono-5-fluoro-4-methylbenzoic acid have?
It has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor count does 3-Borono-5-fluoro-4-methylbenzoic acid have?
It has 5 hydrogen bond acceptor counts.