917202-04-1 Purity
>98
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H12N2.
The molecular weight of the compound is 184.24 g/mol.
The compound was created in PubChem on December 5, 2007.
The Canonical SMILES of the compound is CCN1C(=C(C2=CC=CC=C21)C#N)C.
The compound has 0 hydrogen bond donor counts.
The topological polar surface area of the compound is 28.7 Ų.
The compound has 0 defined atom stereocenter counts.
The XLogP3-AA value of the compound is 2.4.
The compound has 1 rotatable bond count.
Yes, the compound is canonicalized in PubChem.