91702-88-4 Purity
96%
If you have any other questions or need other size, please get a quote.
The IUPAC name of the compound is dimethoxy-phenanthren-9-yl-(2-trimethoxysilylethyl)silane.
The molecular formula of the compound is C21H28O5Si2.
The molecular weight of the compound is 416.6 g/mol.
The InChIKey of the compound is FQFOZTKGYACWRJ-UHFFFAOYSA-N.
The canonical SMILES of the compound is CO[Si](CC[Si](OC)(OC)OC)(C1=CC2=CC=CC=C2C3=CC=CC=C31)OC.
The compound has 0 hydrogen bond donor counts.
The compound has 5 hydrogen bond acceptor counts.
The compound has 9 rotatable bond counts.
The topological polar surface area of the compound is 46.2 ?2.
Yes, the compound is canonicalized.