What is the molecular formula of trans-4-Cyclopropylamino-1,1-dioxo-tetrahydrothiophen-3-ol hydrochloride?
The molecular formula is C7H14ClNO3S.
When was trans-4-Cyclopropylamino-1,1-dioxo-tetrahydrothiophen-3-ol hydrochloride created?
It was created on February 16, 2015.
What is the molecular weight of trans-4-Cyclopropylamino-1,1-dioxo-tetrahydrothiophen-3-ol hydrochloride?
The molecular weight is 227.71 g/mol.
How many hydrogen bond donor counts are there in trans-4-Cyclopropylamino-1,1-dioxo-tetrahydrothiophen-3-ol hydrochloride?
There are 3 hydrogen bond donor counts.
What is the exact mass of trans-4-Cyclopropylamino-1,1-dioxo-tetrahydrothiophen-3-ol hydrochloride?
The exact mass is 227.0382922 g/mol.
How many topological polar surface areas are there in trans-4-Cyclopropylamino-1,1-dioxo-tetrahydrothiophen-3-ol hydrochloride?
The topological polar surface area is 74.8 Ų.
How many defined atom stereocenter counts are there in trans-4-Cyclopropylamino-1,1-dioxo-tetrahydrothiophen-3-ol hydrochloride?
There are 2 defined atom stereocenter counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
What is the Isomeric SMILES of trans-4-Cyclopropylamino-1,1-dioxo-tetrahydrothiophen-3-ol hydrochloride?
The Isomeric SMILES is C1CC1N[C@H]2CS(=O)(=O)C[C@@H]2O.Cl.
What is the InChIKey of trans-4-Cyclopropylamino-1,1-dioxo-tetrahydrothiophen-3-ol hydrochloride?
The InChIKey is YLJGBEWPBCGDSV-LEUCUCNGSA-N.