Danoprevir sodium salt

Name: Danoprevir sodium salt
SKU: ACM916826487
Rating: 5 (1 reviews)

CAS

916826-48-7

Catalog Number

ACM916826487

Category

Other Products

If you have any other questions or need other size, please get a quote.

What is the molecular formula of Danoprevir sodium salt?

The molecular formula of Danoprevir sodium salt is C35H45FN5NaO9S.

When was Danoprevir sodium salt created and modified?

Danoprevir sodium salt was created on 2020-06-10 and modified on 2023-12-30.

What is the molecular weight of Danoprevir sodium salt?

The molecular weight of Danoprevir sodium salt is 753.8 g/mol.

What are the synonyms for Danoprevir sodium salt?

The synonyms for Danoprevir sodium salt are 916826-48-7.

What is the IUPAC name of Danoprevir sodium salt?

The IUPAC name of Danoprevir sodium salt is sodium;cyclopropylsulfonyl-[(4R)-18-(4-fluoro-1,3-dihydroisoindole-2-carbonyl)oxy-14-[(2-methylpropan-2-yl)oxycarbonylamino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.0 4,6 ]nonadec-7-ene-4-carbonyl]azanide.

What is the InChI of Danoprevir sodium salt?

The InChI of Danoprevir sodium salt is InChI=1S/C35H46FN5O9S.Na/c1-34(2,3)50-32(45)37-27-13-8-6-4-5-7-11-22-17-35(22,31(44)39-51(47,48)24-14-15-24)38-29(42)28-16-23(19-41(28)30(27)43)49-33(46)40-18-21-10-9-12-26(36)25(21)20-40;/h7,9-12,22-24,27-28H,4-6,8,13-20H2,1-3H3,(H3,37,38,39,42,44,45);/q;+1/p-1/t22?,23?,27?,28?,35-;/m1./s1.

What is the InChIKey of Danoprevir sodium salt?

The InChIKey of Danoprevir sodium salt is GXYYUDQAGCVAGJ-STNBKFOXSA-M.

What is the canonical SMILES of Danoprevir sodium salt?

The canonical SMILES of Danoprevir sodium salt is CC(C)(C)OC(=O)NC1CCCCCC=CC2CC2(NC(=O)C3CC(CN3C1=O)OC(=O)N4CC5=C(C4)C(=CC=C5)F)C(=O)[N-]S(=O)(=O)C6CC6.[Na+].

How many hydrogen bond donor counts does Danoprevir sodium salt have?

Danoprevir sodium salt has 2 hydrogen bond donor counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.

Recommended Products