What is the molecular formula of Ethyl 3-(6-bromopyridin-2-yl)-3-oxopropanoate?
The molecular formula of Ethyl 3-(6-bromopyridin-2-yl)-3-oxopropanoate is C10H10BrNO3.
When was Ethyl 3-(6-bromopyridin-2-yl)-3-oxopropanoate created and modified?
It was created on 2007-12-05 and modified on 2023-12-30.
What is the IUPAC name of Ethyl 3-(6-bromopyridin-2-yl)-3-oxopropanoate?
The IUPAC name is ethyl 3-(6-bromopyridin-2-yl)-3-oxopropanoate.
What is the InChI of Ethyl 3-(6-bromopyridin-2-yl)-3-oxopropanoate?
The InChI is InChI=1S/C10H10BrNO3/c1-2-15-10(14)6-8(13)7-4-3-5-9(11)12-7/h3-5H,2,6H2,1H3.
How many hydrogen bond acceptor counts does Ethyl 3-(6-bromopyridin-2-yl)-3-oxopropanoate have?
It has 4 hydrogen bond acceptor counts.
What is the Exact Mass of Ethyl 3-(6-bromopyridin-2-yl)-3-oxopropanoate?
The Exact Mass is 270.98441 g/mol.
What is the Topological Polar Surface Area of Ethyl 3-(6-bromopyridin-2-yl)-3-oxopropanoate?
The Topological Polar Surface Area is 56.3 ㎡.
How many defined atom stereocenters does Ethyl 3-(6-bromopyridin-2-yl)-3-oxopropanoate have?
It has 0 defined atom stereocenters.
Is Ethyl 3-(6-bromopyridin-2-yl)-3-oxopropanoate a canonicalized compound?
Yes, it is a canonicalized compound.
What is the Covalently-Bonded Unit Count of Ethyl 3-(6-bromopyridin-2-yl)-3-oxopropanoate?
The Covalently-Bonded Unit Count is 1.