916653-40-2 Purity
96%
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C12H10ClN.
The molecular weight of the compound is 203.67 g/mol.
The IUPAC name of the compound is 4-[(4-chlorophenyl)methyl]pyridine.
The InChI of the compound is InChI=1S/C12H10ClN/c13-12-3-1-10(2-4-12)9-11-5-7-14-8-6-11/h1-8H,9H2.
The InChIKey of the compound is OHKBVLWPESSWKC-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=CC=C1CC2=CC=NC=C2)Cl.
The CAS number of the compound is 4409-11-4.
The EC number of the compound is 224-560-2.
The ChEMBL ID of the compound is CHEMBL1928088.
Yes, the compound is canonicalized according to PubChem.