CAS
916574-87-3 Purity
---
916574-87-3 Purity
---
Inquiry Basket
2-Bromo-3-hydroxybenzoic acid
CAS
91658-91-2
Catalog Number
ACM91658912
Category
Other Products
Molecular Formula
C7H5BrO3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromo-3-hydroxybenzoic acid?
The molecular formula of 2-Bromo-3-hydroxybenzoic acid is C7H5BrO3.
What is the molecular weight of 2-Bromo-3-hydroxybenzoic acid?
The molecular weight of 2-Bromo-3-hydroxybenzoic acid is 217.02 g/mol.
What is the IUPAC name of 2-Bromo-3-hydroxybenzoic acid?
The IUPAC name of 2-Bromo-3-hydroxybenzoic acid is 2-bromo-3-hydroxybenzoic acid.
What is the InChI of 2-Bromo-3-hydroxybenzoic acid?
The InChI of 2-Bromo-3-hydroxybenzoic acid is InChI=1S/C7H5BrO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3,9H,(H,10,11).
What is the InChIKey of 2-Bromo-3-hydroxybenzoic acid?
The InChIKey of 2-Bromo-3-hydroxybenzoic acid is GBPZLKQDSNPABG-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-3-hydroxybenzoic acid?
The canonical SMILES of 2-Bromo-3-hydroxybenzoic acid is C1=CC(=C(C(=C1)O)Br)C(=O)O.
What is the CAS number of 2-Bromo-3-hydroxybenzoic acid?
The CAS number of 2-Bromo-3-hydroxybenzoic acid is 91658-91-2.
What is the molecular weight of 2-Bromo-3-hydroxybenzoic acid according to PubChem?
The molecular weight of 2-Bromo-3-hydroxybenzoic acid is 217.02 g/mol according to PubChem.
How many hydrogen bond donor counts does 2-Bromo-3-hydroxybenzoic acid have?
2-Bromo-3-hydroxybenzoic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Bromo-3-hydroxybenzoic acid have?
2-Bromo-3-hydroxybenzoic acid has 3 hydrogen bond acceptor counts.
Recommended Products
![1H-Pyrrolo[2,3-b]pyridine, 4-methoxy-1-(phenylsulfonyl)-](https://resource.alfa-chemistry.com/structure/916574-87-3.gif)
![3-Dimethylamino-2-[1-(4-methoxy-benzyl)-1H-tetrazol-5-yl]-acrylic acid ethyl ester](https://resource.alfa-chemistry.com/structure/91660-68-3.gif)
CAS
91660-68-3 Purity
---
91660-68-3 Purity
---
