What is the molecular formula of 2-Pyrrolidinone,1-[(2-methyl-1H-imidazol-5-yl)methyl]-?
The molecular formula is C9H13N3O.
What is the molecular weight of 2-Pyrrolidinone,1-[(2-methyl-1H-imidazol-5-yl)methyl]-?
The molecular weight is 179.22 g/mol.
What is the IUPAC name of 2-Pyrrolidinone,1-[(2-methyl-1H-imidazol-5-yl)methyl]-?
The IUPAC name is 1-[(2-methyl-1H-imidazol-5-yl)methyl]pyrrolidin-2-one.
What is the InChI of 2-Pyrrolidinone,1-[(2-methyl-1H-imidazol-5-yl)methyl]-?
The InChI is InChI=1S/C9H13N3O/c1-7-10-5-8(11-7)6-12-4-2-3-9(12)13/h5H,2-4,6H2,1H3,(H,10,11).
What is the InChIKey of 2-Pyrrolidinone,1-[(2-methyl-1H-imidazol-5-yl)methyl]-?
The InChIKey is DLZVSRZPABRHMI-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Pyrrolidinone,1-[(2-methyl-1H-imidazol-5-yl)methyl]-?
The canonical SMILES is CC1=NC=C(N1)CN2CCCC2=O.
What is the XLogP3-AA value of 2-Pyrrolidinone,1-[(2-methyl-1H-imidazol-5-yl)methyl]-?
The XLogP3-AA value is -0.1.
How many hydrogen bond donor counts does 2-Pyrrolidinone,1-[(2-methyl-1H-imidazol-5-yl)methyl]- have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Pyrrolidinone,1-[(2-methyl-1H-imidazol-5-yl)methyl]- have?
It has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does 2-Pyrrolidinone,1-[(2-methyl-1H-imidazol-5-yl)methyl]- have?
It has 2 rotatable bond counts.