916203-52-6 Purity
98%
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 1-(2-chloroethyl)-3-(furan-2-ylmethyl)urea.
The molecular formula of the compound is C8H11ClN2O2.
The molecular weight of the compound is 202.64 g/mol.
The InChI of the compound is InChI=1S/C8H11ClN2O2/c9-3-4-10-8(12)11-6-7-2-1-5-13-7/h1-2,5H,3-4,6H2,(H2,10,11,12).
The InChIKey of the compound is VVYXILGQLAJZQA-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=COC(=C1)CNC(=O)NCCCl.
The CAS number of the compound is 91621-12-4.
The compound has 2 hydrogen bond donor counts.
The compound has 2 hydrogen bond acceptor counts.
The compound has 4 rotatable bond counts.