What is the molecular formula of (6,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The molecular formula is C12H13NO3.
What is the molecular weight of (6,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The molecular weight is 219.24 g/mol.
What is the IUPAC name of (6,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The IUPAC name is 2-(6,7-dimethyl-2-oxo-1,3-dihydroindol-3-yl)acetic acid.
What is the InChI of (6,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The InChI is InChI=1S/C12H13NO3/c1-6-3-4-8-9(5-10(14)15)12(16)13-11(8)7(6)2/h3-4,9H,5H2,1-2H3,(H,13,16)(H,14,15).
What is the InChIKey of (6,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The InChIKey is MYHSYPBQJXLHGH-UHFFFAOYSA-N.
What is the canonical SMILES of (6,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The canonical SMILES is CC1=C(C2=C(C=C1)C(C(=O)N2)CC(=O)O)C.
What is the XLogP3-AA value of (6,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The XLogP3-AA value is 1.
How many hydrogen bond donor counts does (6,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does (6,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid have?
It has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does (6,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid have?
It has 2 rotatable bond counts.