What is the molecular formula of (4,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The molecular formula is C12H13NO3.
What is the PubChem CID of (4,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The PubChem CID is 45791030.
What is the IUPAC name of (4,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The IUPAC name is 2-(4,7-dimethyl-2-oxo-1,3-dihydroindol-3-yl)acetic acid.
What is the InChI of (4,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The InChI is InChI=1S/C12H13NO3/c1-6-3-4-7(2)11-10(6)8(5-9(14)15)12(16)13-11/h3-4,8H,5H2,1-2H3,(H,13,16)(H,14,15).
What is the InChIKey of (4,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The InChIKey is SOSVVLLFFNVGFR-UHFFFAOYSA-N.
What is the canonical SMILES of (4,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The canonical SMILES is CC1=C2C(C(=O)NC2=C(C=C1)C)CC(=O)O.
What is the molecular weight of (4,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
The molecular weight is 219.24 g/mol.
How many hydrogen bond donors are there in (4,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
There are 2 hydrogen bond donors.
How many hydrogen bond acceptors are there in (4,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
There are 3 hydrogen bond acceptors.
How many rotatable bonds are there in (4,7-Dimethyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid?
There are 2 rotatable bonds.