What is the IUPAC name of Benzoylchloride,3-(3-methyl-1,2,4-oxadiazol-5-yl)?
The IUPAC name is 3-(3-methyl-1,2,4-oxadiazol-5-yl)benzoyl chloride.
What is the molecular formula of Benzoylchloride,3-(3-methyl-1,2,4-oxadiazol-5-yl)?
The molecular formula is C10H7ClN2O2.
What is the molecular weight of Benzoylchloride,3-(3-methyl-1,2,4-oxadiazol-5-yl)?
The molecular weight is 222.63 g/mol.
What is the InChI of Benzoylchloride,3-(3-methyl-1,2,4-oxadiazol-5-yl)?
The InChI is InChI=1S/C10H7ClN2O2/c1-6-12-10(15-13-6)8-4-2-3-7(5-8)9(11)14/h2-5H,1H3.
What is the InChIKey of Benzoylchloride,3-(3-methyl-1,2,4-oxadiazol-5-yl)?
The InChIKey is OSKVPCDSIORYNO-UHFFFAOYSA-N.
What is the Canonical SMILES of Benzoylchloride,3-(3-methyl-1,2,4-oxadiazol-5-yl)?
The Canonical SMILES is CC1=NOC(=N1)C2=CC(=CC=C2)C(=O)Cl.
How many hydrogen bond acceptor count does Benzoylchloride,3-(3-methyl-1,2,4-oxadiazol-5-yl) have?
It has 4 hydrogen bond acceptor count.
What is the topological polar surface area of Benzoylchloride,3-(3-methyl-1,2,4-oxadiazol-5-yl)?
The topological polar surface area is 56 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
When was Benzoylchloride,3-(3-methyl-1,2,4-oxadiazol-5-yl) created and last modified?
It was created on 2008-02-29 and last modified on 2023-12-30.