N-(2-Succinyl)phenylephrine(mixture of diastereomers)

CAS

915278-80-7

Catalog Number

ACM915278807

Category

Other Products

Molecular Weight

283.28

Molecular Formula

C₁₃H₁₇NO₆

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

N-[(2R)-2-Hydroxy-2-(3-hydroxyphenyl)ethyl]-N-methylaspartic Acid

What is the molecular formula of N-(2-Succinyl)phenylephrine?

The molecular formula of N-(2-Succinyl)phenylephrine is C13H17NO6.

What is the molecular weight of N-(2-Succinyl)phenylephrine?

The molecular weight of N-(2-Succinyl)phenylephrine is 283.28 g/mol.

When was N-(2-Succinyl)phenylephrine created?

N-(2-Succinyl)phenylephrine was created on November 1, 2013.

What is the IUPAC name of N-(2-Succinyl)phenylephrine?

The IUPAC name of N-(2-Succinyl)phenylephrine is 2-[[(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]butanedioic acid.

What is the InChI of N-(2-Succinyl)phenylephrine?

The InChI of N-(2-Succinyl)phenylephrine is InChI=1S/C13H17NO6/c1-14(10(13(19)20)6-12(17)18)7-11(16)8-3-2-4-9(15)5-8/h2-5,10-11,15-16H,6-7H2,1H3,(H,17,18)(H,19,20)/t10?,11-/m0/s1.

What is the InChIKey of N-(2-Succinyl)phenylephrine?

The InChIKey of N-(2-Succinyl)phenylephrine is NILXUFZCPICFBR-DTIOYNMSSA-N.

What are the synonyms of N-(2-Succinyl)phenylephrine?

The synonyms of N-(2-Succinyl)phenylephrine are 915278-80-7, 2-[[(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]butanedioic acid, N-(2-Succinyl)phenylephrine(mixture of diastereomers), N-(2-Succinyl) Phenylephrine(Mixture of Diastereomers) (>85%).

What is the XLogP3-AA value of N-(2-Succinyl)phenylephrine?

The XLogP3-AA value of N-(2-Succinyl)phenylephrine is -2.4.

How many hydrogen bond donor counts does N-(2-Succinyl)phenylephrine have?

N-(2-Succinyl)phenylephrine has 4 hydrogen bond donor counts.

How many rotatable bond counts does N-(2-Succinyl)phenylephrine have?

N-(2-Succinyl)phenylephrine has 7 rotatable bond counts.

Recommended Products