CAS
91493-94-6 Purity
---
91493-94-6 Purity
---
Shopping basket
ACETAMIDE,N-[2-(6-ETHYNYL-PYRIDIN-2-YL)ETHYL]-
CAS
914950-55-3
Catalog Number
ACM914950553
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula is C11H12N2O.
What are the synonyms of the compound?
The synonyms of the compound are 914950-55-3, ACETAMIDE,N-[2-(6-ETHYNYL-PYRIDIN-2-YL)ETHYL]-, and SCHEMBL3039143.
What is the molecular weight of the compound?
The molecular weight is 188.23 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is N-[2-(6-ethynylpyridin-2-yl)ethyl]acetamide.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C11H12N2O/c1-3-10-5-4-6-11(13-10)7-8-12-9(2)14/h1,4-6H,7-8H2,2H3,(H,12,14).
What is the InChIKey of the compound?
The InChIKey of the compound is SRWFZJWOAJZLRU-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC(=O)NCCC1=NC(=CC=C1)C#C.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 0.7.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many rotatable bond counts does the compound have?
The compound has 4 rotatable bond counts.
Recommended Products
![2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-ol](https://resource.alfa-chemistry.com/structure/91493-94-6.gif)
![ACETAMIDE,N-[1-(6-ETHYNYL-PYRIDIN-2-YL)ETHYL]-](https://resource.alfa-chemistry.com/structure/914950-80-4.gif)
