914637-99-3 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 3-Cyano-6-hydroxypyridone sodium salt is C6H3N2NaO2.
The molecular weight of 3-Cyano-6-hydroxypyridone sodium salt is 158.09 g/mol.
The IUPAC name of 3-Cyano-6-hydroxypyridone sodium salt is sodium;5-cyano-6-oxo-1H-pyridin-2-olate.
The InChI of 3-Cyano-6-hydroxypyridone sodium salt is InChI=1S/C6H4N2O2.Na/c7-3-4-1-2-5(9)8-6(4)10;/h1-2H,(H2,8,9,10);/q;+1/p-1.
The InChIKey of 3-Cyano-6-hydroxypyridone sodium salt is AQWWPGVNDQWIDY-UHFFFAOYSA-M.
The canonical SMILES of 3-Cyano-6-hydroxypyridone sodium salt is C1=C(C(=O)NC(=C1)[O-])C#N.[Na+].
The hydrogen bond donor count of 3-Cyano-6-hydroxypyridone sodium salt is 1, and the hydrogen bond acceptor count is 3.
There are no rotatable bonds in 3-Cyano-6-hydroxypyridone sodium salt.
The topological polar surface area of 3-Cyano-6-hydroxypyridone sodium salt is 76?2.
There are 11 heavy atoms in 3-Cyano-6-hydroxypyridone sodium salt.