914613-35-7 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H8BrF3O.
The computed IUPAC Name of the compound is 4-bromo-1-prop-1-en-2-yloxy-2-(trifluoromethyl)benzene.
The InChI of the compound is InChI=1S/C10H8BrF3O/c1-6(2)15-9-4-3-7(11)5-8(9)10(12,13)14/h3-5H,1H2,2H3.
The InChIKey of the compound is YVFBDTUMPJHJKQ-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC(=C)OC1=C(C=C(C=C1)Br)C(F)(F)F.
The CAS number of the compound is 914635-61-3.
The molecular weight of the compound is 281.07 g/mol.
The XLogP3-AA value of the compound is 4.3.
The compound has 0 hydrogen bond donor counts.
The compound has 4 hydrogen bond acceptor counts.