What is the molecular formula of Carbamic acid,(5-bromopyrazinyl)-, 1,1-dimethylethyl ester (9CI)?
The molecular formula is C9H12BrN3O2.
When was Carbamic acid,(5-bromopyrazinyl)-, 1,1-dimethylethyl ester (9CI) created in PubChem?
It was created on 2009-07-21.
What is the IUPAC Name of Carbamic acid,(5-bromopyrazinyl)-, 1,1-dimethylethyl ester (9CI)?
The IUPAC Name is tert-butyl N-(5-bromopyrazin-2-yl)carbamate.
What is the InChIKey of Carbamic acid,(5-bromopyrazinyl)-, 1,1-dimethylethyl ester (9CI)?
The InChIKey is PNYUSBALYDXDRK-UHFFFAOYSA-N.
What is the Canonical SMILES of Carbamic acid,(5-bromopyrazinyl)-, 1,1-dimethylethyl ester (9CI)?
The Canonical SMILES is CC(C)(C)OC(=O)NC1=CN=C(C=N1)Br.
What is the molecular weight of Carbamic acid,(5-bromopyrazinyl)-, 1,1-dimethylethyl ester (9CI)?
The molecular weight is 274.11 g/mol.
What is the CAS identifier for Carbamic acid,(5-bromopyrazinyl)-, 1,1-dimethylethyl ester (9CI)?
The CAS identifier is 914349-79-4.
How many hydrogen bond donor counts does Carbamic acid,(5-bromopyrazinyl)-, 1,1-dimethylethyl ester (9CI) have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of Carbamic acid,(5-bromopyrazinyl)-, 1,1-dimethylethyl ester (9CI)?
The topological polar surface area is 64.1 Ų.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.