What is the molecular formula of 2-(3,4-Dimethoxyphenyl)thiazole-5-carbaldehyde?
The molecular formula is C12H11NO3S.
What is the molecular weight of 2-(3,4-Dimethoxyphenyl)thiazole-5-carbaldehyde?
The molecular weight is 249.29 g/mol.
What is the IUPAC name of 2-(3,4-Dimethoxyphenyl)thiazole-5-carbaldehyde?
The IUPAC name is 2-(3,4-dimethoxyphenyl)-1,3-thiazole-5-carbaldehyde.
What is the InChI of 2-(3,4-Dimethoxyphenyl)thiazole-5-carbaldehyde?
The InChI is InChI=1S/C12H11NO3S/c1-15-10-4-3-8(5-11(10)16-2)12-13-6-9(7-14)17-12/h3-7H,1-2H3.
What is the InChIKey of 2-(3,4-Dimethoxyphenyl)thiazole-5-carbaldehyde?
The InChIKey is PVFZZVFDLGBCDQ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-(3,4-Dimethoxyphenyl)thiazole-5-carbaldehyde?
The canonical SMILES is COC1=C(C=C(C=C1)C2=NC=C(S2)C=O)OC.
How many hydrogen bond donor counts does 2-(3,4-Dimethoxyphenyl)thiazole-5-carbaldehyde have?
It has 0 hydrogen bond donor counts.
What is the exact mass of 2-(3,4-Dimethoxyphenyl)thiazole-5-carbaldehyde?
The exact mass is 249.04596439 g/mol.
What is the topological polar surface area of 2-(3,4-Dimethoxyphenyl)thiazole-5-carbaldehyde?
The topological polar surface area is 76.7 Ų.
Is 2-(3,4-Dimethoxyphenyl)thiazole-5-carbaldehyde a canonicalized compound?
Yes, it is a canonicalized compound.