91365-84-3 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 5-(phenoxymethyl)furan-2-carboxylic acid.
The molecular weight of the compound is 218.20 g/mol.
The InChI of the compound is InChI=1S/C12H10O4/c13-12(14)11-7-6-10(16-11)8-15-9-4-2-1-3-5-9/h1-7H,8H2,(H,13,14).
The InChIKey of the compound is KPSLIMYRDNBEGK-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC=C(C=C1)OCC2=CC=C(O2)C(=O)O.
The CAS number of the compound is 91368-74-0.
The EC number of the compound is 866-449-7.
The XLogP3-AA value of the compound is 2.3.
The compound has 1 hydrogen bond donor count.
The compound has 4 rotatable bond counts.