What is the molecular formula of 2-Phenyl-piperazine-1-carboxylic acid benzyl ester?
The molecular formula is C18H20N2O2.
When was 2-Phenyl-piperazine-1-carboxylic acid benzyl ester created and last modified in PubChem?
It was created on October 2, 2007, and last modified on December 30, 2023.
What is the IUPAC name of 2-Phenyl-piperazine-1-carboxylic acid benzyl ester?
The IUPAC name is benzyl 2-phenylpiperazine-1-carboxylate.
What is the InChI of 2-Phenyl-piperazine-1-carboxylic acid benzyl ester?
The InChI is InChI=1S/C18H20N2O2/c21-18(22-14-15-7-3-1-4-8-15)20-12-11-19-13-17(20)16-9-5-2-6-10-16/h1-10,17,19H,11-14H2
What is the InChIKey of 2-Phenyl-piperazine-1-carboxylic acid benzyl ester?
The InChIKey is OSZLLPOULCKUCI-UHFFFAOYSA-N
What is the Canonical SMILES of 2-Phenyl-piperazine-1-carboxylic acid benzyl ester?
The Canonical SMILES is C1CN(C(CN1)C2=CC=CC=C2)C(=O)OCC3=CC=CC=C3
What is the molecular weight of 2-Phenyl-piperazine-1-carboxylic acid benzyl ester?
The molecular weight is 296.4 g/mol.
How many hydrogen bond donor counts are there in 2-Phenyl-piperazine-1-carboxylic acid benzyl ester?
There is 1 hydrogen bond donor count.
What is the topological polar surface area of 2-Phenyl-piperazine-1-carboxylic acid benzyl ester?
The topological polar surface area is 41.6?2.
Is 2-Phenyl-piperazine-1-carboxylic acid benzyl ester a canonicalized compound?
Yes, it is a canonicalized compound.