What is the molecular formula of 1,4,6,7-Tetrahydrothiopyrano[4,3-c]pyrazole-3-carboxylic acid?
The molecular formula is C7H8N2O2S.
What is the molecular weight of 1,4,6,7-Tetrahydrothiopyrano[4,3-c]pyrazole-3-carboxylic acid?
The molecular weight is 184.22 g/mol.
What is the IUPAC name of 1,4,6,7-Tetrahydrothiopyrano[4,3-c]pyrazole-3-carboxylic acid?
The IUPAC name is 1,4,6-tetrahydrothiopyrano[4,3-c]pyrazole-3-carboxylic acid.
What is the InChI of 1,4,6,7-Tetrahydrothiopyrano[4,3-c]pyrazole-3-carboxylic acid?
The InChI is InChI=1S/C7H8N2O2S/c10-7(11)6-4-3-12-2-1-5(4)8-9-6/h1-3H2,(H,8,9)(H,10,11).
What is the InChIKey of 1,4,6,7-Tetrahydrothiopyrano[4,3-c]pyrazole-3-carboxylic acid?
The InChIKey is GOXLZCBVDQVTMO-UHFFFAOYSA-N.
What is the canonical SMILES representation of 1,4,6,7-Tetrahydrothiopyrano[4,3-c]pyrazole-3-carboxylic acid?
The canonical SMILES representation is C1CSCC2=C1NN=C2C(=O)O.
What is the CAS number of 1,4,6,7-Tetrahydrothiopyrano[4,3-c]pyrazole-3-carboxylic acid?
The CAS number is 912635-70-2.
How many hydrogen bond donor atoms are present in 1,4,6,7-Tetrahydrothiopyrano[4,3-c]pyrazole-3-carboxylic acid?
There are 2 hydrogen bond donor atoms.
How many hydrogen bond acceptor atoms are present in 1,4,6,7-Tetrahydrothiopyrano[4,3-c]pyrazole-3-carboxylic acid?
There are 4 hydrogen bond acceptor atoms.