CAS
91197-54-5 Purity
---
91197-54-5 Purity
---
![2-(Carboxymethyl)-2,4-dihydroxy-4-oxobutanoate;diethyl-[2-(5-phenyl-1,2-oxazol-3-yl)ethyl]azanium](https://resource.alfa-chemistry.com/structure/912-02-7.gif)
Inquiry Basket
Benzyl 4-(benzyloxy)-3-methoxybenzoate
CAS
91203-74-6
Catalog Number
ACM91203746
Category
Other Products
Molecular Weight
348.39
Molecular Formula
C22H20O4
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of benzyl 4-(benzyloxy)-3-methoxybenzoate?
The molecular formula is C22H20O4.
When was benzyl 4-(benzyloxy)-3-methoxybenzoate first created in PubChem?
It was first created on December 5, 2007.
What is the molecular weight of benzyl 4-(benzyloxy)-3-methoxybenzoate?
The molecular weight is 348.4 g/mol.
What is the IUPAC name of benzyl 4-(benzyloxy)-3-methoxybenzoate?
The IUPAC name is benzyl 3-methoxy-4-phenylmethoxybenzoate.
How many hydrogen bond acceptor count does benzyl 4-(benzyloxy)-3-methoxybenzoate have?
It has 4 hydrogen bond acceptor counts.
What is the canonical SMILES representation of benzyl 4-(benzyloxy)-3-methoxybenzoate?
COC1=C(C=CC(=C1)C(=O)OCC2=CC=CC=C2)OCC3=CC=CC=C3
Does benzyl 4-(benzyloxy)-3-methoxybenzoate have any defined atom stereocenter count?
No, it does not have any defined atom stereocenter count.
What is the XLogP3-AA value of benzyl 4-(benzyloxy)-3-methoxybenzoate?
The XLogP3-AA value is 4.7.
How many rotatable bond count does benzyl 4-(benzyloxy)-3-methoxybenzoate have?
It has 8 rotatable bond counts.
Is benzyl 4-(benzyloxy)-3-methoxybenzoate considered a canonicalized compound in PubChem?
Yes, it is considered a canonicalized compound.
Recommended Products
![Benzoic acid,2-[(2-hydroxybenzoyl)amino]-,(1ar,1bs,4r,4as,7as,7bs,8r,9r,9as)-9a-(acetyloxy)-1a,1b,4,4a,5,7a,7b,8,9,9a-decahydro-4,4a,7b-trihydroxy-3-(hydroxymethyl)-1,1,6,8-tetramethyl-5-oxo-1H-cyclop](https://resource.alfa-chemistry.com/structure/91197-54-5.gif)
