CAS
91159-31-8 Purity
96%
91159-31-8 Purity
96%
Inquiry Basket
4-trans-(4-fluorophenyl)cyclohexanecarboxylic acid
CAS
91161-90-9
Catalog Number
ACM91161909
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-trans-(4-fluorophenyl)cyclohexanecarboxylic acid?
The molecular formula of 4-trans-(4-fluorophenyl)cyclohexanecarboxylic acid is C13H15FO2.
What is the molecular weight of 4-trans-(4-fluorophenyl)cyclohexanecarboxylic acid?
The molecular weight of 4-trans-(4-fluorophenyl)cyclohexanecarboxylic acid is 222.25 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of 4-trans-(4-fluorophenyl)cyclohexanecarboxylic acid is 4-(4-fluorophenyl)cyclohexane-1-carboxylic acid.
What is the InChI of 4-trans-(4-fluorophenyl)cyclohexanecarboxylic acid?
The InChI of 4-trans-(4-fluorophenyl)cyclohexanecarboxylic acid is InChI=1S/C13H15FO2/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(15)16/h5-9,11H,1-4H2,(H,15,16).
How many hydrogen bond donor counts are there in 4-trans-(4-fluorophenyl)cyclohexanecarboxylic acid?
There is 1 hydrogen bond donor count in 4-trans-(4-fluorophenyl)cyclohexanecarboxylic acid.
How many hydrogen bond acceptor counts are there in the compound?
There are 3 hydrogen bond acceptor counts in 4-trans-(4-fluorophenyl)cyclohexanecarboxylic acid.
What is the topological polar surface area of the compound?
The topological polar surface area of 4-trans-(4-fluorophenyl)cyclohexanecarboxylic acid is 37.3 Å^2.
How many rotatable bond counts are there in 4-trans-(4-fluorophenyl)cyclohexanecarboxylic acid?
There are 2 rotatable bond counts in the compound.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Is there any defined atom stereocenter count in 4-trans-(4-fluorophenyl)cyclohexanecarboxylic acid?
No, there are no defined atom stereocenter counts in the compound.
Recommended Products
CAS
91162-04-8 Purity
99%+
91162-04-8 Purity
99%+
![[1,4']Bipiperidinyl-2-carboxylic acid ethyl ester](https://resource.alfa-chemistry.com/structure/911627-08-2.gif)
