CAS
91147-50-1 Purity
---
91147-50-1 Purity
---
Inquiry Basket
Acetovanillone
CAS
911498-02-2
Catalog Number
ACM911498022
Category
Other Products
Molecular Formula
C8H4N2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of Acetovanillone?
The molecular formula of Acetovanillone is C9H10O3.
What is the molecular weight of Acetovanillone?
The molecular weight of Acetovanillone is 166.17 g/mol.
What are some synonyms for Acetovanillone?
Some synonyms for Acetovanillone include apocynin, 4'-Hydroxy-3'-methoxyacetophenone, and 1-(4-Hydroxy-3-methoxyphenyl)ethanone.
What is the IUPAC name of Acetovanillone?
The IUPAC name of Acetovanillone is 1-(4-hydroxy-3-methoxyphenyl)ethanone.
What is the InChIKey of Acetovanillone?
The InChIKey of Acetovanillone is DFYRUELUNQRZTB-UHFFFAOYSA-N.
What is the Canonical SMILES of Acetovanillone?
The Canonical SMILES of Acetovanillone is CC(=O)C1=CC(=C(C=C1)O)OC.
What is the CAS number of Acetovanillone?
The CAS number of Acetovanillone is 498-02-2.
What is the XLogP3 value of Acetovanillone?
The XLogP3 value of Acetovanillone is 0.5.
How many hydrogen bond acceptors does Acetovanillone have?
Acetovanillone has 3 hydrogen bond acceptors.
What is the topological polar surface area of Acetovanillone?
The topological polar surface area of Acetovanillone is 46.5 Å2.
Recommended Products
