CAS
91085-70-0 Purity
97%
91085-70-0 Purity
97%
Shopping basket
Piperazine,1-(oxiranylmethyl)-4-(2-propenyl)-(9ci)
CAS
91087-27-3
Catalog Number
ACM91087273
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is 1-(oxiran-2-ylmethyl)-4-prop-2-enylpiperazine.
What is the molecular formula of the compound?
The molecular formula of the compound is C10H18N2O.
What is the molecular weight of the compound?
The molecular weight of the compound is 182.26 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C10H18N2O/c1-2-3-11-4-6-12(7-5-11)8-10-9-13-10/h2,10H,1,3-9H2.
What is the InChIKey of the compound?
The InChIKey of the compound is KVZXHMCQCFGPGN-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C=CCN1CCN(CC1)CC2CO2.
What is the CAS number of the compound?
The CAS number of the compound is 91087-27-3.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 0.4.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
How many rotatable bond counts does the compound have?
The compound has 4 rotatable bond counts.
Recommended Products
