What is the molecular formula of 2-Aminomethyl-3-(2-fluorophenyl)propionic acid?
The molecular formula of 2-Aminomethyl-3-(2-fluorophenyl)propionic acid is C10H12FNO2.
When was 2-Aminomethyl-3-(2-fluorophenyl)propionic acid first created and modified?
It was first created on 2008-02-29 and last modified on 2023-12-30.
What is the IUPAC name of 2-Aminomethyl-3-(2-fluorophenyl)propionic acid?
The IUPAC name is 2-(aminomethyl)-3-(2-fluorophenyl)propanoic acid.
What is the InChI of 2-Aminomethyl-3-(2-fluorophenyl)propionic acid?
The InChI is InChI=1S/C10H12FNO2/c11-9-4-2-1-3-7(9)5-8(6-12)10(13)14/h1-4,8H,5-6,12H2,(H,13,14).
What is the Canonical SMILES of 2-Aminomethyl-3-(2-fluorophenyl)propionic acid?
The Canonical SMILES is C1=CC=C(C(=C1)CC(CN)C(=O)O)F.
How much is the molecular weight of 2-Aminomethyl-3-(2-fluorophenyl)propionic acid?
The molecular weight is 197.21 g/mol.
What is the XLogP3-AA value of 2-Aminomethyl-3-(2-fluorophenyl)propionic acid?
The XLogP3-AA value is -1.4.
How many hydrogen bond donor counts does 2-Aminomethyl-3-(2-fluorophenyl)propionic acid have?
It has 2 hydrogen bond donor counts.
What is the exact mass and monoisotopic mass of 2-Aminomethyl-3-(2-fluorophenyl)propionic acid?
The exact mass and monoisotopic mass are 197.08520679 g/mol.
Is 2-Aminomethyl-3-(2-fluorophenyl)propionic acid a canonicalized compound?
Yes, it is a canonicalized compound.