What is the molecular formula of Pentafluorophenyl 6-(tetrahydropyran-4-yloxy)nicotinate?
The molecular formula of Pentafluorophenyl 6-(tetrahydropyran-4-yloxy)nicotinate is C17H12F5NO4.
What is the molecular weight of Pentafluorophenyl 6-(tetrahydropyran-4-yloxy)nicotinate?
The molecular weight of Pentafluorophenyl 6-(tetrahydropyran-4-yloxy)nicotinate is 389.27 g/mol.
What is the IUPAC name of Pentafluorophenyl 6-(tetrahydropyran-4-yloxy)nicotinate?
The IUPAC name is (2,3,4,5,6-pentafluorophenyl) 6-(oxan-4-yloxy)pyridine-3-carboxylate.
What is the InChI key of Pentafluorophenyl 6-(tetrahydropyran-4-yloxy)nicotinate?
The InChI key is DOADFHHFWSVLLM-UHFFFAOYSA-N.
What is the canonical SMILES of Pentafluorophenyl 6-(tetrahydropyran-4-yloxy)nicotinate?
The canonical SMILES is C1COCCC1OC2=NC=C(C=C2)C(=O)OC3=C(C(=C(C(=C3F)F)F)F)F.
How many hydrogen bond acceptors does Pentafluorophenyl 6-(tetrahydropyran-4-yloxy)nicotinate have?
It has 10 hydrogen bond acceptors.
What is the topological polar surface area of Pentafluorophenyl 6-(tetrahydropyran-4-yloxy)nicotinate?
The topological polar surface area is 57.6?2.
How many rotatable bond counts does Pentafluorophenyl 6-(tetrahydropyran-4-yloxy)nicotinate have?
It has 5 rotatable bond counts.
Is Pentafluorophenyl 6-(tetrahydropyran-4-yloxy)nicotinate a canonicalized compound?
Yes, it is a canonicalized compound.
What is the exact mass of Pentafluorophenyl 6-(tetrahydropyran-4-yloxy)nicotinate?
The exact mass is 389.06864867 g/mol.