91404-24-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of N-Phenylanthranilic acid is C13H11NO2.
Some synonyms of N-Phenylanthranilic acid include Fenamic acid, 2-(Phenylamino)benzoic acid, and 2-Anilinobenzoic acid.
The molecular weight of N-Phenylanthranilic acid is 213.23 g/mol.
The IUPAC name of N-Phenylanthranilic acid is 2-anilinobenzoic acid.
The InChI key of N-Phenylanthranilic acid is ZWJINEZUASEZBH-UHFFFAOYSA-N.
The Canonical SMILES of N-Phenylanthranilic acid is C1=CC=C(C=C1)NC2=CC=CC=C2C(=O)O.
The CAS number of N-Phenylanthranilic acid is 91-40-7.
The XLogP3 value of N-Phenylanthranilic acid is 4.4.
There are 2 hydrogen bond donor counts in N-Phenylanthranilic acid.
The exact mass of N-Phenylanthranilic acid is 213.078978594 g/mol.