Benzthiazide

CAS

91-33-8

Catalog Number

ACM91338

Category

Other Products

Molecular Weight

431.92

Molecular Formula

C₁₅H₁₄ClN₃O₄S₃

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

What is the molecular formula of benzthiazide?

The molecular formula of benzthiazide is C15H14ClN3O4S3.

What is the molecular weight of benzthiazide?

The molecular weight of benzthiazide is 431.9 g/mol.

What is the role of benzthiazide?

Benzthiazide has a role as a diuretic and an antihypertensive agent.

How does benzthiazide promote water loss from the body?

Benzthiazide promotes water loss from the body by inhibiting Na+/Cl- reabsorption from the distal convoluted tubules in the kidneys.

What are some synonyms for benzthiazide?

Some synonyms for benzthiazide are Aquatag and Dihydrex.

What is the IUPAC name of benzthiazide?

The IUPAC name of benzthiazide is 3-(benzylsulfanylmethyl)-6-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-7-sulfonamide.

What is the InChI of benzthiazide?

The InChI of benzthiazide is InChI=1S/C15H14ClN3O4S3/c16-11-6-12-14(7-13(11)25(17,20)21)26(22,23)19-15(18-12)9-24-8-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,18,19)(H2,17,20,21).

Why are thiazides often used to treat hypertension?

Thiazides are often used to treat hypertension because they have been shown to prevent hypertension-related morbidity and mortality, although the mechanism is not fully understood.

What is the Canonical SMILES of benzthiazide?

The Canonical SMILES of benzthiazide is C1=CC=C(C=C1)CSCC2=NS(=O)(=O)C3=CC(=C(C=C3N2)Cl)S(=O)(=O)N.

Is benzthiazide commercially available in the United States?

Benzthiazide, also known as benzothiazide, is no longer commercially available in the United States.

Recommended Products