909532-61-2 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H10O3S.
The molecular weight of the compound is 186.23 g/mol.
The IUPAC name of the compound is methyl 2-(furan-2-ylmethylsulfanyl)acetate.
The InChI of the compound is InChI=1S/C8H10O3S/c1-10-8(9)6-12-5-7-3-2-4-11-7/h2-4H,5-6H2,1H3.
The InChIKey of the compound is XPVNCXPHDABNLE-UHFFFAOYSA-N.
The canonical SMILES of the compound is COC(=O)CSCC1=CC=CO1.
The CAS number of the compound is 108499-33-8.
The XLogP3-AA value of the compound is 1.4.
The compound has 0 hydrogen bond donor counts.
The compound has 5 rotatable bond counts.
[Other Products] Fluorphlogopite(Mg3K[AlF2O(SiO3)3]) Catalog: ACM12003382 CAS: 12003-38-2 |