909187-37-7 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H13BrO3.
The molecular weight of the compound is 285.13 g/mol.
The IUPAC name of the compound is ethyl 4-(2-bromophenyl)-3-oxobutanoate.
The InChI of the compound is InChI=1S/C12H13BrO3/c1-2-16-12(15)8-10(14)7-9-5-3-4-6-11(9)13/h3-6H,2,7-8H2,1H3.
The InChIKey of the compound is VYZLJMJWBQRSJY-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCOC(=O)CC(=O)CC1=CC=CC=C1Br.
The XLogP3-AA value of the compound is 2.6.
The compound has 0 hydrogen bond donor counts.
The compound has 3 hydrogen bond acceptor counts.
The compound has 6 rotatable bond counts.