What is the molecular formula of Carbamic acid, (5-ethyl-2-thiazolyl)-,2,2,2-trichloroethyl ester(9ci)?
The molecular formula is C8H9Cl3N2O2S.
What is the molecular weight of Carbamic acid, (5-ethyl-2-thiazolyl)-,2,2,2-trichloroethyl ester(9ci)?
The molecular weight is 303.6 g/mol.
What is the IUPAC name of Carbamic acid, (5-ethyl-2-thiazolyl)-,2,2,2-trichloroethyl ester(9ci)?
The IUPAC name is 2,2,2-trichloroethyl N-(5-ethyl-1,3-thiazol-2-yl)carbamate.
What is the InChI of Carbamic acid, (5-ethyl-2-thiazolyl)-,2,2,2-trichloroethyl ester(9ci)?
The InChI is InChI=1S/C8H9Cl3N2O2S/c1-2-5-3-12-6(16-5)13-7(14)15-4-8(9,10)11/h3H,2,4H2,1H3,(H,12,13,14).
What is the InChIKey of Carbamic acid, (5-ethyl-2-thiazolyl)-,2,2,2-trichloroethyl ester(9ci)?
The InChIKey is ZDBWNFISCKKUQA-UHFFFAOYSA-N.
What is the canonical SMILES representation of Carbamic acid, (5-ethyl-2-thiazolyl)-,2,2,2-trichloroethyl ester(9ci)?
The canonical SMILES is CCC1=CN=C(S1)NC(=O)OCC(Cl)(Cl)Cl.
What is the XLogP3-AA value of Carbamic acid, (5-ethyl-2-thiazolyl)-,2,2,2-trichloroethyl ester(9ci)?
The XLogP3-AA value is 3.6.
How many hydrogen bond donor counts does Carbamic acid, (5-ethyl-2-thiazolyl)-,2,2,2-trichloroethyl ester(9ci) have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Carbamic acid, (5-ethyl-2-thiazolyl)-,2,2,2-trichloroethyl ester(9ci) have?
It has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does Carbamic acid, (5-ethyl-2-thiazolyl)-,2,2,2-trichloroethyl ester(9ci) have?
It has 4 rotatable bond counts.