908248-27-1 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C24H19NO3.
The molecular weight of the compound is 369.4 g/mol.
The IUPAC name of the compound is benzyl 8-phenylmethoxyquinoline-7-carboxylate.
The InChI of the compound is InChI=1S/C24H19NO3/c26-24(28-17-19-10-5-2-6-11-19)21-14-13-20-12-7-15-25-22(20)23(21)27-16-18-8-3-1-4-9-18/h1-15H,16-17H2.
The InChIKey of the compound is KHRZTUDKDVGMDA-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC=C(C=C1)COC2=C(C=CC3=C2N=CC=C3)C(=O)OCC4=CC=CC=C4.
The XLogP3-AA value of the compound is 5.
The compound has 0 hydrogen bond donor counts.
The compound has 4 hydrogen bond acceptor counts.
The compound has 7 rotatable bond counts.