What is the molecular formula of (S)-a-Bromo-a-(4-methyl phenyl)-acetonitril?
The molecular formula is C9H8BrN.
What is the molecular weight of (S)-a-Bromo-a-(4-methyl phenyl)-acetonitril?
The molecular weight is 210.07 g/mol.
What is the IUPAC name of (S)-a-Bromo-a-(4-methyl phenyl)-acetonitril?
The IUPAC name is (2S)-2-bromo-2-(4-methylphenyl)acetonitrile.
What is the InChI of (S)-a-Bromo-a-(4-methyl phenyl)-acetonitril?
The InChI is InChI=1S/C9H8BrN/c1-7-2-4-8(5-3-7)9(10)6-11/h2-5,9H,1H3/t9-/m1/s1.
What is the InChIKey of (S)-a-Bromo-a-(4-methyl phenyl)-acetonitril?
The InChIKey is YBIQPQMYTPHDFH-SECBINFHSA-N.
What is the canonical SMILES of (S)-a-Bromo-a-(4-methyl phenyl)-acetonitril?
The canonical SMILES is CC1=CC=C(C=C1)C(C#N)Br.
What is the isomeric SMILES of (S)-a-Bromo-a-(4-methyl phenyl)-acetonitril?
The isomeric SMILES is CC1=CC=C(C=C1)[C@@H](C#N)Br.
What is the XLogP3-AA value of (S)-a-Bromo-a-(4-methyl phenyl)-acetonitril?
The XLogP3-AA value is 2.8.
How many hydrogen bond donor counts does (S)-a-Bromo-a-(4-methyl phenyl)-acetonitril have?
It has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does (S)-a-Bromo-a-(4-methyl phenyl)-acetonitril have?
It has 1 hydrogen bond acceptor count.